C25H31F2N5S — CID 145239356
N-[[4-[5-(difluoromethyl)-4H-pyrazol-3-yl]phenyl]methyl]-N-[2-(4-ethylpiperazin-1-yl)ethylsulfanyl]aniline (PubChem CID 145239356) has the molecular formula C25H31F2N5S and a molecular weight of 471.62 g/mol. Its IUPAC name is N-[[4-[5-(difluoromethyl)-4H-pyrazol-3-yl]phenyl]methyl]-N-[2-(4-ethylpiperazin-1-yl)ethylsulfanyl]aniline.
| Compound Name | N-[[4-[5-(difluoromethyl)-4H-pyrazol-3-yl]phenyl]methyl]-N-[2-(4-ethylpiperazin-1-yl)ethylsulfanyl]aniline |
|---|---|
| PubChem CID | 145239356 |
| Molecular Formula | C25H31F2N5S |
| Molecular Weight | 471.62 g/mol |
| Exact Mass | 471.23 |
| IUPAC Name | N-[[4-[5-(difluoromethyl)-4H-pyrazol-3-yl]phenyl]methyl]-N-[2-(4-ethylpiperazin-1-yl)ethylsulfanyl]aniline |
| SMILES | CCN1CCN(CCSN(Cc2ccc(C3=NN=C(C(F)F)C3)cc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C25H31F2N5S/c1-2-30-12-14-31(15-13-30)16-17-33-32(22-6-4-3-5-7-22)19-20-8-10-21(11-9-20)23-18-24(25(26)27)29-28-23/h3-11,25H,2,12-19H2,1H3 |
| InChIKey | KPDAWASSZOBRKQ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 34.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.62 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|