C25H39N5S — CID 145239215
N-[[4-(1-hydrazinylethenyl)phenyl]methyl]-N-[2-(4-methylpiperazin-1-yl)ethylsulfanyl]aniline;propane (PubChem CID 145239215) has the molecular formula C25H39N5S and a molecular weight of 441.69 g/mol. Its IUPAC name is N-[[4-(1-hydrazinylethenyl)phenyl]methyl]-N-[2-(4-methylpiperazin-1-yl)ethylsulfanyl]aniline;propane.
| Compound Name | N-[[4-(1-hydrazinylethenyl)phenyl]methyl]-N-[2-(4-methylpiperazin-1-yl)ethylsulfanyl]aniline;propane |
|---|---|
| PubChem CID | 145239215 |
| Molecular Formula | C25H39N5S |
| Molecular Weight | 441.69 g/mol |
| Exact Mass | 441.29 |
| IUPAC Name | N-[[4-(1-hydrazinylethenyl)phenyl]methyl]-N-[2-(4-methylpiperazin-1-yl)ethylsulfanyl]aniline;propane |
| SMILES | C=C(NN)c1ccc(CN(SCCN2CCN(C)CC2)c2ccccc2)cc1.CCC |
| InChI | InChI=1S/C22H31N5S.C3H8/c1-19(24-23)21-10-8-20(9-11-21)18-27(22-6-4-3-5-7-22)28-17-16-26-14-12-25(2)13-15-26;1-3-2/h3-11,24H,1,12-18,23H2,2H3;3H2,1-2H3 |
| InChIKey | IZGPBEGRRBEWAK-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 47.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.69 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|