C26H36F2N4OS — CID 145238534
N-[[4-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]phenyl]methyl]-3-methyl-N-piperidin-4-ylsulfanylaniline;ethane (PubChem CID 145238534) has the molecular formula C26H36F2N4OS and a molecular weight of 490.66 g/mol. Its IUPAC name is N-[[4-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]phenyl]methyl]-3-methyl-N-piperidin-4-ylsulfanylaniline;ethane.
| Compound Name | N-[[4-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]phenyl]methyl]-3-methyl-N-piperidin-4-ylsulfanylaniline;ethane |
|---|---|
| PubChem CID | 145238534 |
| Molecular Formula | C26H36F2N4OS |
| Molecular Weight | 490.66 g/mol |
| Exact Mass | 490.26 |
| IUPAC Name | N-[[4-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]phenyl]methyl]-3-methyl-N-piperidin-4-ylsulfanylaniline;ethane |
| SMILES | CC.CC.Cc1cccc(N(Cc2ccc(-c3nnc(C(F)F)o3)cc2)SC2CCNCC2)c1 |
| InChI | InChI=1S/C22H24F2N4OS.2C2H6/c1-15-3-2-4-18(13-15)28(30-19-9-11-25-12-10-19)14-16-5-7-17(8-6-16)21-26-27-22(29-21)20(23)24;2*1-2/h2-8,13,19-20,25H,9-12,14H2,1H3;2*1-2H3 |
| InChIKey | FRZSMVULASZOMJ-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 54.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.66 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|