C21H16F2N4OS — CID 145239313
N-[[4-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]phenyl]methyl]-N-pyridin-3-ylsulfanylaniline (PubChem CID 145239313) has the molecular formula C21H16F2N4OS and a molecular weight of 410.45 g/mol. Its IUPAC name is N-[[4-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]phenyl]methyl]-N-pyridin-3-ylsulfanylaniline.
| Compound Name | N-[[4-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]phenyl]methyl]-N-pyridin-3-ylsulfanylaniline |
|---|---|
| PubChem CID | 145239313 |
| Molecular Formula | C21H16F2N4OS |
| Molecular Weight | 410.45 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | N-[[4-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]phenyl]methyl]-N-pyridin-3-ylsulfanylaniline |
| SMILES | FC(F)c1nnc(-c2ccc(CN(Sc3cccnc3)c3ccccc3)cc2)o1 |
| InChI | InChI=1S/C21H16F2N4OS/c22-19(23)21-26-25-20(28-21)16-10-8-15(9-11-16)14-27(17-5-2-1-3-6-17)29-18-7-4-12-24-13-18/h1-13,19H,14H2 |
| InChIKey | SCIWHSPXRHGKOG-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 55.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.45 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|