C19H21N3O4S — CID 126541179
methyl 4-[[(1-ethylindazol-6-yl)-methylsulfonylamino]methyl]benzoate (PubChem CID 126541179) has the molecular formula C19H21N3O4S and a molecular weight of 387.46 g/mol. Its IUPAC name is methyl 4-[[(1-ethylindazol-6-yl)-methylsulfonylamino]methyl]benzoate.
| Compound Name | methyl 4-[[(1-ethylindazol-6-yl)-methylsulfonylamino]methyl]benzoate |
|---|---|
| PubChem CID | 126541179 |
| Molecular Formula | C19H21N3O4S |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | methyl 4-[[(1-ethylindazol-6-yl)-methylsulfonylamino]methyl]benzoate |
| SMILES | CCn1ncc2ccc(N(Cc3ccc(C(=O)OC)cc3)S(C)(=O)=O)cc21 |
| InChI | InChI=1S/C19H21N3O4S/c1-4-21-18-11-17(10-9-16(18)12-20-21)22(27(3,24)25)13-14-5-7-15(8-6-14)19(23)26-2/h5-12H,4,13H2,1-3H3 |
| InChIKey | KJDBZHIKTSTQNY-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |