About methyl 4-[(3,5-dichloro-2-pyridinyl)-[(1-methylindazol-5-yl)methyl]sulfamoyl]-3-ethylbenzoate
methyl 4-[(3,5-dichloro-2-pyridinyl)-[(1-methylindazol-5-yl)methyl]sulfamoyl]-3-ethylbenzoate (PubChem CID 66837833) has the molecular formula C24H22Cl2N4O4S
and a molecular weight of 533.44 g/mol. Its IUPAC name is methyl 4-[(3,5-dichloro-2-pyridinyl)-[(1-methylindazol-5-yl)methyl]sulfamoyl]-3-ethylbenzoate.
Molecular Properties
| Compound Name | methyl 4-[(3,5-dichloro-2-pyridinyl)-[(1-methylindazol-5-yl)methyl]sulfamoyl]-3-ethylbenzoate |
| PubChem CID | 66837833 |
| Molecular Formula | C24H22Cl2N4O4S |
| Molecular Weight | 533.44 g/mol |
| Exact Mass | 532.07 |
| IUPAC Name | methyl 4-[(3,5-dichloro-2-pyridinyl)-[(1-methylindazol-5-yl)methyl]sulfamoyl]-3-ethylbenzoate |
| SMILES | CCc1cc(C(=O)OC)ccc1S(=O)(=O)N(Cc1ccc2c(cnn2C)c1)c1ncc(Cl)cc1Cl |
| InChI | InChI=1S/C24H22Cl2N4O4S/c1-4-16-10-17(24(31)34-3)6-8-22(16)35(32,33)30(23-20(26)11-19(25)13-27-23)14-15-5-7-21-18(9-15)12-28-29(21)2/h5-13H,4,14H2,1-3H3 |
| InChIKey | CRKCPHLRBJGXPY-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 94.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 533.44 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl 4-[(3,5-dichloro-2-pyridinyl)-[(1-methylindazol-5-yl)methyl]sulfamoyl]-3-ethylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[(3,5-dichloro-2-pyridinyl)-[(1-methylindazol-5-yl)methyl]sulfamoyl]-3-ethylbenzoate?
The IUPAC name of methyl 4-[(3,5-dichloro-2-pyridinyl)-[(1-methylindazol-5-yl)methyl]sulfamoyl]-3-ethylbenzoate (CID 66837833) is methyl 4-[(3,5-dichloro-2-pyridinyl)-[(1-methylindazol-5-yl)methyl]sulfamoyl]-3-ethylbenzoate.
What is the SMILES notation for methyl 4-[(3,5-dichloro-2-pyridinyl)-[(1-methylindazol-5-yl)methyl]sulfamoyl]-3-ethylbenzoate?
The canonical SMILES for methyl 4-[(3,5-dichloro-2-pyridinyl)-[(1-methylindazol-5-yl)methyl]sulfamoyl]-3-ethylbenzoate is CCc1cc(C(=O)OC)ccc1S(=O)(=O)N(Cc1ccc2c(cnn2C)c1)c1ncc(Cl)cc1Cl.
What is the InChIKey of methyl 4-[(3,5-dichloro-2-pyridinyl)-[(1-methylindazol-5-yl)methyl]sulfamoyl]-3-ethylbenzoate?
The InChIKey is CRKCPHLRBJGXPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H22Cl2N4O4S/c1-4-16-10-17(24(31)34-3)6-8-22(16)35(32,33)30(23-20(26)11-19(25)13-27-23)14-15-5-7-21-18(9-15)12-28-29(21)2/h5-13H,4,14H2,1-3H3.
What are the key properties of methyl 4-[(3,5-dichloro-2-pyridinyl)-[(1-methylindazol-5-yl)methyl]sulfamoyl]-3-ethylbenzoate?
methyl 4-[(3,5-dichloro-2-pyridinyl)-[(1-methylindazol-5-yl)methyl]sulfamoyl]-3-ethylbenzoate has a molecular weight of 533.44 g/mol, XLogP of 5.02, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[(3,5-dichloro-2-pyridinyl)-[(1-methylindazol-5-yl)methyl]sulfamoyl]-3-ethylbenzoate is sourced from PubChem (CID 66837833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).