C20H20O4 — CID 70278572
2,2-bis(4-ethylphenyl)-1,3-dioxane-4,6-dione (PubChem CID 70278572) has the molecular formula C20H20O4 and a molecular weight of 324.38 g/mol. Its IUPAC name is 2,2-bis(4-ethylphenyl)-1,3-dioxane-4,6-dione.
| Compound Name | 2,2-bis(4-ethylphenyl)-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 70278572 |
| Molecular Formula | C20H20O4 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | 2,2-bis(4-ethylphenyl)-1,3-dioxane-4,6-dione |
| SMILES | CCc1ccc(C2(c3ccc(CC)cc3)OC(=O)CC(=O)O2)cc1 |
| InChI | InChI=1S/C20H20O4/c1-3-14-5-9-16(10-6-14)20(23-18(21)13-19(22)24-20)17-11-7-15(4-2)8-12-17/h5-12H,3-4,13H2,1-2H3 |
| InChIKey | FTQVBLOTLUOOBS-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|