C22H40N4O3S — CID 143104250
1-[1-cyclohexyl-2-(2-formylpyrrolidin-1-yl)-2-oxoethyl]-3-[3,3-dimethyl-1-[methyl(methylsulfanyl)amino]butan-2-yl]urea (PubChem CID 143104250) has the molecular formula C22H40N4O3S and a molecular weight of 440.65 g/mol. Its IUPAC name is 1-[1-cyclohexyl-2-(2-formylpyrrolidin-1-yl)-2-oxoethyl]-3-[3,3-dimethyl-1-[methyl(methylsulfanyl)amino]butan-2-yl]urea.
| Compound Name | 1-[1-cyclohexyl-2-(2-formylpyrrolidin-1-yl)-2-oxoethyl]-3-[3,3-dimethyl-1-[methyl(methylsulfanyl)amino]butan-2-yl]urea |
|---|---|
| PubChem CID | 143104250 |
| Molecular Formula | C22H40N4O3S |
| Molecular Weight | 440.65 g/mol |
| Exact Mass | 440.28 |
| IUPAC Name | 1-[1-cyclohexyl-2-(2-formylpyrrolidin-1-yl)-2-oxoethyl]-3-[3,3-dimethyl-1-[methyl(methylsulfanyl)amino]butan-2-yl]urea |
| SMILES | CSN(C)CC(NC(=O)NC(C(=O)N1CCCC1C=O)C1CCCCC1)C(C)(C)C |
| InChI | InChI=1S/C22H40N4O3S/c1-22(2,3)18(14-25(4)30-5)23-21(29)24-19(16-10-7-6-8-11-16)20(28)26-13-9-12-17(26)15-27/h15-19H,6-14H2,1-5H3,(H2,23,24,29) |
| InChIKey | BAZTVHITAYOQKT-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.65 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|