C23H45N5O3S — CID 143354824
1-[3,3-dimethyl-1-[2-[propan-2-yl(sulfanyl)amino]ethylamino]butan-2-yl]-3-[1-(2-formylpyrrolidin-1-yl)-3,3-dimethyl-1-oxobutan-2-yl]urea (PubChem CID 143354824) has the molecular formula C23H45N5O3S and a molecular weight of 471.71 g/mol. Its IUPAC name is 1-[3,3-dimethyl-1-[2-[propan-2-yl(sulfanyl)amino]ethylamino]butan-2-yl]-3-[1-(2-formylpyrrolidin-1-yl)-3,3-dimethyl-1-oxobutan-2-yl]urea.
| Compound Name | 1-[3,3-dimethyl-1-[2-[propan-2-yl(sulfanyl)amino]ethylamino]butan-2-yl]-3-[1-(2-formylpyrrolidin-1-yl)-3,3-dimethyl-1-oxobutan-2-yl]urea |
|---|---|
| PubChem CID | 143354824 |
| Molecular Formula | C23H45N5O3S |
| Molecular Weight | 471.71 g/mol |
| Exact Mass | 471.32 |
| IUPAC Name | 1-[3,3-dimethyl-1-[2-[propan-2-yl(sulfanyl)amino]ethylamino]butan-2-yl]-3-[1-(2-formylpyrrolidin-1-yl)-3,3-dimethyl-1-oxobutan-2-yl]urea |
| SMILES | CC(C)N(S)CCNCC(NC(=O)NC(C(=O)N1CCCC1C=O)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C23H45N5O3S/c1-16(2)28(32)13-11-24-14-18(22(3,4)5)25-21(31)26-19(23(6,7)8)20(30)27-12-9-10-17(27)15-29/h15-19,24,32H,9-14H2,1-8H3,(H2,25,26,31) |
| InChIKey | HKDZOWCMMGRFJB-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.71 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|