C32H51N5O6S — CID 143362846
1-[1-(2-formylpyrrolidin-1-yl)-3,3-dimethyl-1-oxobutan-2-yl]-3-(3-methyl-1-oxo-1-phenylbutan-2-yl)urea;methylcyclobutane;2-oxo-3-(sulfanylamino)butanamide (PubChem CID 143362846) has the molecular formula C32H51N5O6S and a molecular weight of 633.86 g/mol. Its IUPAC name is 1-[1-(2-formylpyrrolidin-1-yl)-3,3-dimethyl-1-oxobutan-2-yl]-3-(3-methyl-1-oxo-1-phenylbutan-2-yl)urea;methylcyclobutane;2-oxo-3-(sulfanylamino)butanamide.
| Compound Name | 1-[1-(2-formylpyrrolidin-1-yl)-3,3-dimethyl-1-oxobutan-2-yl]-3-(3-methyl-1-oxo-1-phenylbutan-2-yl)urea;methylcyclobutane;2-oxo-3-(sulfanylamino)butanamide |
|---|---|
| PubChem CID | 143362846 |
| Molecular Formula | C32H51N5O6S |
| Molecular Weight | 633.86 g/mol |
| Exact Mass | 633.36 |
| IUPAC Name | 1-[1-(2-formylpyrrolidin-1-yl)-3,3-dimethyl-1-oxobutan-2-yl]-3-(3-methyl-1-oxo-1-phenylbutan-2-yl)urea;methylcyclobutane;2-oxo-3-(sulfanylamino)butanamide |
| SMILES | CC(C)C(NC(=O)NC(C(=O)N1CCCC1C=O)C(C)(C)C)C(=O)c1ccccc1.CC(NS)C(=O)C(N)=O.CC1CCC1 |
| InChI | InChI=1S/C23H33N3O4.C5H10.C4H8N2O2S/c1-15(2)18(19(28)16-10-7-6-8-11-16)24-22(30)25-20(23(3,4)5)21(29)26-13-9-12-17(26)14-27;1-5-3-2-4-5;1-2(6-9)3(7)4(5)8/h6-8,10-11,14-15,17-18,20H,9,12-13H2,1-5H3,(H2,24,25,30);5H,2-4H2,1H3;2,6,9H,1H3,(H2,5,8) |
| InChIKey | OQDCHNKCXGCSOW-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 167.77 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.86 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|