C29H43N3O4 — CID 143361374
1-(1-cyclohexyl-2-oxo-2-phenylethyl)-3-[1-(2-formyl-4-propan-2-ylpyrrolidin-1-yl)-3,3-dimethyl-1-oxobutan-2-yl]urea (PubChem CID 143361374) has the molecular formula C29H43N3O4 and a molecular weight of 497.68 g/mol. Its IUPAC name is 1-(1-cyclohexyl-2-oxo-2-phenylethyl)-3-[1-(2-formyl-4-propan-2-ylpyrrolidin-1-yl)-3,3-dimethyl-1-oxobutan-2-yl]urea.
| Compound Name | 1-(1-cyclohexyl-2-oxo-2-phenylethyl)-3-[1-(2-formyl-4-propan-2-ylpyrrolidin-1-yl)-3,3-dimethyl-1-oxobutan-2-yl]urea |
|---|---|
| PubChem CID | 143361374 |
| Molecular Formula | C29H43N3O4 |
| Molecular Weight | 497.68 g/mol |
| Exact Mass | 497.33 |
| IUPAC Name | 1-(1-cyclohexyl-2-oxo-2-phenylethyl)-3-[1-(2-formyl-4-propan-2-ylpyrrolidin-1-yl)-3,3-dimethyl-1-oxobutan-2-yl]urea |
| SMILES | CC(C)C1CC(C=O)N(C(=O)C(NC(=O)NC(C(=O)c2ccccc2)C2CCCCC2)C(C)(C)C)C1 |
| InChI | InChI=1S/C29H43N3O4/c1-19(2)22-16-23(18-33)32(17-22)27(35)26(29(3,4)5)31-28(36)30-24(20-12-8-6-9-13-20)25(34)21-14-10-7-11-15-21/h7,10-11,14-15,18-20,22-24,26H,6,8-9,12-13,16-17H2,1-5H3,(H2,30,31,36) |
| InChIKey | YKULCCWBODAWBN-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.68 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|