C25H35N3O5 — CID 143358514
benzyl 2-[[1-cyclohexyl-2-(4-ethyl-2-formylpyrrolidin-1-yl)-2-oxoethyl]carbamoylamino]acetate (PubChem CID 143358514) has the molecular formula C25H35N3O5 and a molecular weight of 457.57 g/mol. Its IUPAC name is benzyl 2-[[1-cyclohexyl-2-(4-ethyl-2-formylpyrrolidin-1-yl)-2-oxoethyl]carbamoylamino]acetate.
| Compound Name | benzyl 2-[[1-cyclohexyl-2-(4-ethyl-2-formylpyrrolidin-1-yl)-2-oxoethyl]carbamoylamino]acetate |
|---|---|
| PubChem CID | 143358514 |
| Molecular Formula | C25H35N3O5 |
| Molecular Weight | 457.57 g/mol |
| Exact Mass | 457.26 |
| IUPAC Name | benzyl 2-[[1-cyclohexyl-2-(4-ethyl-2-formylpyrrolidin-1-yl)-2-oxoethyl]carbamoylamino]acetate |
| SMILES | CCC1CC(C=O)N(C(=O)C(NC(=O)NCC(=O)OCc2ccccc2)C2CCCCC2)C1 |
| InChI | InChI=1S/C25H35N3O5/c1-2-18-13-21(16-29)28(15-18)24(31)23(20-11-7-4-8-12-20)27-25(32)26-14-22(30)33-17-19-9-5-3-6-10-19/h3,5-6,9-10,16,18,20-21,23H,2,4,7-8,11-15,17H2,1H3,(H2,26,27,32) |
| InChIKey | MNHQRCVZLWIMGR-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.57 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|