C32H57N5O6S — CID 143102423
1-(1-cyclohexyl-3-methyl-1-oxobutan-2-yl)-3-[1-(2-formylpyrrolidin-1-yl)-3,3-dimethyl-1-oxobutan-2-yl]urea;5-methyl-2-oxo-3-(sulfanylamino)octanamide (PubChem CID 143102423) has the molecular formula C32H57N5O6S and a molecular weight of 639.90 g/mol. Its IUPAC name is 1-(1-cyclohexyl-3-methyl-1-oxobutan-2-yl)-3-[1-(2-formylpyrrolidin-1-yl)-3,3-dimethyl-1-oxobutan-2-yl]urea;5-methyl-2-oxo-3-(sulfanylamino)octanamide.
| Compound Name | 1-(1-cyclohexyl-3-methyl-1-oxobutan-2-yl)-3-[1-(2-formylpyrrolidin-1-yl)-3,3-dimethyl-1-oxobutan-2-yl]urea;5-methyl-2-oxo-3-(sulfanylamino)octanamide |
|---|---|
| PubChem CID | 143102423 |
| Molecular Formula | C32H57N5O6S |
| Molecular Weight | 639.90 g/mol |
| Exact Mass | 639.40 |
| IUPAC Name | 1-(1-cyclohexyl-3-methyl-1-oxobutan-2-yl)-3-[1-(2-formylpyrrolidin-1-yl)-3,3-dimethyl-1-oxobutan-2-yl]urea;5-methyl-2-oxo-3-(sulfanylamino)octanamide |
| SMILES | CC(C)C(NC(=O)NC(C(=O)N1CCCC1C=O)C(C)(C)C)C(=O)C1CCCCC1.CCCC(C)CC(NS)C(=O)C(N)=O |
| InChI | InChI=1S/C23H39N3O4.C9H18N2O2S/c1-15(2)18(19(28)16-10-7-6-8-11-16)24-22(30)25-20(23(3,4)5)21(29)26-13-9-12-17(26)14-27;1-3-4-6(2)5-7(11-14)8(12)9(10)13/h14-18,20H,6-13H2,1-5H3,(H2,24,25,30);6-7,11,14H,3-5H2,1-2H3,(H2,10,13) |
| InChIKey | APLVXBGWXKIHQH-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 167.77 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.90 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|