C31H49N5O6 — CID 20846032
N-(4-amino-1-cyclobutyl-3,4-dioxobutan-2-yl)-2-[2-[(1-cyclopropyl-3-methyl-1-oxobutan-2-yl)carbamoylamino]-3,3-dimethylbutanoyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide (PubChem CID 20846032) has the molecular formula C31H49N5O6 and a molecular weight of 587.76 g/mol. Its IUPAC name is N-(4-amino-1-cyclobutyl-3,4-dioxobutan-2-yl)-2-[2-[(1-cyclopropyl-3-methyl-1-oxobutan-2-yl)carbamoylamino]-3,3-dimethylbutanoyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide.
| Compound Name | N-(4-amino-1-cyclobutyl-3,4-dioxobutan-2-yl)-2-[2-[(1-cyclopropyl-3-methyl-1-oxobutan-2-yl)carbamoylamino]-3,3-dimethylbutanoyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 20846032 |
| Molecular Formula | C31H49N5O6 |
| Molecular Weight | 587.76 g/mol |
| Exact Mass | 587.37 |
| IUPAC Name | N-(4-amino-1-cyclobutyl-3,4-dioxobutan-2-yl)-2-[2-[(1-cyclopropyl-3-methyl-1-oxobutan-2-yl)carbamoylamino]-3,3-dimethylbutanoyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide |
| SMILES | CC(C)C(NC(=O)NC(C(=O)N1CC2CCCC2C1C(=O)NC(CC1CCC1)C(=O)C(N)=O)C(C)(C)C)C(=O)C1CC1 |
| InChI | InChI=1S/C31H49N5O6/c1-16(2)22(24(37)18-12-13-18)34-30(42)35-26(31(3,4)5)29(41)36-15-19-10-7-11-20(19)23(36)28(40)33-21(25(38)27(32)39)14-17-8-6-9-17/h16-23,26H,6-15H2,1-5H3,(H2,32,39)(H,33,40)(H2,34,35,42) |
| InChIKey | IOCDMHYRTJGWNY-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 167.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.76 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|