C23H42N4O5 — CID 143363425
(3aS)-2-(2-aminoacetyl)-N-(4-amino-1-cyclobutyl-3,4-dioxobutan-2-yl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide;methanol;2-methylpropane (PubChem CID 143363425) has the molecular formula C23H42N4O5 and a molecular weight of 454.61 g/mol. Its IUPAC name is (3aS)-2-(2-aminoacetyl)-N-(4-amino-1-cyclobutyl-3,4-dioxobutan-2-yl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide;methanol;2-methylpropane.
| Compound Name | (3aS)-2-(2-aminoacetyl)-N-(4-amino-1-cyclobutyl-3,4-dioxobutan-2-yl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide;methanol;2-methylpropane |
|---|---|
| PubChem CID | 143363425 |
| Molecular Formula | C23H42N4O5 |
| Molecular Weight | 454.61 g/mol |
| Exact Mass | 454.32 |
| IUPAC Name | (3aS)-2-(2-aminoacetyl)-N-(4-amino-1-cyclobutyl-3,4-dioxobutan-2-yl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide;methanol;2-methylpropane |
| SMILES | CC(C)C.CO.NCC(=O)N1CC2CCC[C@@H]2C1C(=O)NC(CC1CCC1)C(=O)C(N)=O |
| InChI | InChI=1S/C18H28N4O4.C4H10.CH4O/c19-8-14(23)22-9-11-5-2-6-12(11)15(22)18(26)21-13(16(24)17(20)25)7-10-3-1-4-10;1-4(2)3;1-2/h10-13,15H,1-9,19H2,(H2,20,25)(H,21,26);4H,1-3H3;2H,1H3/t11?,12-,13?,15?;;/m0../s1 |
| InChIKey | BUHVIMUGUCQJJD-APSUHDCNSA-N |
| XLogP | 0.57 |
| TPSA | 155.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.61 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|