C16H27N3O3 — CID 143102629
(4R)-N-(4-amino-1-cyclobutyl-3,4-dioxobutan-2-yl)-4-ethyl-1-methylpyrrolidine-2-carboxamide (PubChem CID 143102629) has the molecular formula C16H27N3O3 and a molecular weight of 309.41 g/mol. Its IUPAC name is (4R)-N-(4-amino-1-cyclobutyl-3,4-dioxobutan-2-yl)-4-ethyl-1-methylpyrrolidine-2-carboxamide.
| Compound Name | (4R)-N-(4-amino-1-cyclobutyl-3,4-dioxobutan-2-yl)-4-ethyl-1-methylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 143102629 |
| Molecular Formula | C16H27N3O3 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.21 |
| IUPAC Name | (4R)-N-(4-amino-1-cyclobutyl-3,4-dioxobutan-2-yl)-4-ethyl-1-methylpyrrolidine-2-carboxamide |
| SMILES | CC[C@@H]1CC(C(=O)NC(CC2CCC2)C(=O)C(N)=O)N(C)C1 |
| InChI | InChI=1S/C16H27N3O3/c1-3-10-8-13(19(2)9-10)16(22)18-12(14(20)15(17)21)7-11-5-4-6-11/h10-13H,3-9H2,1-2H3,(H2,17,21)(H,18,22)/t10-,12?,13?/m1/s1 |
| InChIKey | MXIYNIJOSGITIJ-QFWMXSHPSA-N |
| XLogP | 0.45 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|