C8H15N2O2P — CID 59655546
4-cyclobutyl-2-oxo-3-(phosphanylamino)butanamide (PubChem CID 59655546) has the molecular formula C8H15N2O2P and a molecular weight of 202.19 g/mol. Its IUPAC name is 4-cyclobutyl-2-oxo-3-(phosphanylamino)butanamide.
| Compound Name | 4-cyclobutyl-2-oxo-3-(phosphanylamino)butanamide |
|---|---|
| PubChem CID | 59655546 |
| Molecular Formula | C8H15N2O2P |
| Molecular Weight | 202.19 g/mol |
| Exact Mass | 202.09 |
| IUPAC Name | 4-cyclobutyl-2-oxo-3-(phosphanylamino)butanamide |
| SMILES | NC(=O)C(=O)C(CC1CCC1)NP |
| InChI | InChI=1S/C8H15N2O2P/c9-8(12)7(11)6(10-13)4-5-2-1-3-5/h5-6,10H,1-4,13H2,(H2,9,12) |
| InChIKey | ABRBNQNOIUHLBF-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.19 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|