C14H26N2O2 — CID 58331760
3-(tert-butylamino)-4-cyclobutyl-N-ethyl-2-oxobutanamide (PubChem CID 58331760) has the molecular formula C14H26N2O2 and a molecular weight of 254.37 g/mol. Its IUPAC name is 3-(tert-butylamino)-4-cyclobutyl-N-ethyl-2-oxobutanamide.
| Compound Name | 3-(tert-butylamino)-4-cyclobutyl-N-ethyl-2-oxobutanamide |
|---|---|
| PubChem CID | 58331760 |
| Molecular Formula | C14H26N2O2 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.20 |
| IUPAC Name | 3-(tert-butylamino)-4-cyclobutyl-N-ethyl-2-oxobutanamide |
| SMILES | CCNC(=O)C(=O)C(CC1CCC1)NC(C)(C)C |
| InChI | InChI=1S/C14H26N2O2/c1-5-15-13(18)12(17)11(16-14(2,3)4)9-10-7-6-8-10/h10-11,16H,5-9H2,1-4H3,(H,15,18) |
| InChIKey | BKBRBPYCCYDKLA-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|