C29H44N6O6S — CID 143352439
4-cyclopropyl-2-oxo-3-(sulfanylamino)butanamide;1-[1-(2-formylpyrrolidin-1-yl)-3,3-dimethyl-1-oxobutan-2-yl]-3-(3-methyl-1-oxo-1-pyridin-3-ylbutan-2-yl)urea (PubChem CID 143352439) has the molecular formula C29H44N6O6S and a molecular weight of 604.77 g/mol. Its IUPAC name is 4-cyclopropyl-2-oxo-3-(sulfanylamino)butanamide;1-[1-(2-formylpyrrolidin-1-yl)-3,3-dimethyl-1-oxobutan-2-yl]-3-(3-methyl-1-oxo-1-pyridin-3-ylbutan-2-yl)urea.
| Compound Name | 4-cyclopropyl-2-oxo-3-(sulfanylamino)butanamide;1-[1-(2-formylpyrrolidin-1-yl)-3,3-dimethyl-1-oxobutan-2-yl]-3-(3-methyl-1-oxo-1-pyridin-3-ylbutan-2-yl)urea |
|---|---|
| PubChem CID | 143352439 |
| Molecular Formula | C29H44N6O6S |
| Molecular Weight | 604.77 g/mol |
| Exact Mass | 604.30 |
| IUPAC Name | 4-cyclopropyl-2-oxo-3-(sulfanylamino)butanamide;1-[1-(2-formylpyrrolidin-1-yl)-3,3-dimethyl-1-oxobutan-2-yl]-3-(3-methyl-1-oxo-1-pyridin-3-ylbutan-2-yl)urea |
| SMILES | CC(C)C(NC(=O)NC(C(=O)N1CCCC1C=O)C(C)(C)C)C(=O)c1cccnc1.NC(=O)C(=O)C(CC1CC1)NS |
| InChI | InChI=1S/C22H32N4O4.C7H12N2O2S/c1-14(2)17(18(28)15-8-6-10-23-12-15)24-21(30)25-19(22(3,4)5)20(29)26-11-7-9-16(26)13-27;8-7(11)6(10)5(9-12)3-4-1-2-4/h6,8,10,12-14,16-17,19H,7,9,11H2,1-5H3,(H2,24,25,30);4-5,9,12H,1-3H2,(H2,8,11) |
| InChIKey | UIOGXGXQQKDUDV-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 180.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.77 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|