C34H49N5O5S — CID 143104425
1-[2-[[1-[[benzylsulfanyl(methyl)amino]methyl]cyclohexyl]carbamoylamino]-3,3-dimethylbutanoyl]-N-(1,2-dioxohept-6-yn-3-yl)pyrrolidine-2-carboxamide (PubChem CID 143104425) has the molecular formula C34H49N5O5S and a molecular weight of 639.86 g/mol. Its IUPAC name is 1-[2-[[1-[[benzylsulfanyl(methyl)amino]methyl]cyclohexyl]carbamoylamino]-3,3-dimethylbutanoyl]-N-(1,2-dioxohept-6-yn-3-yl)pyrrolidine-2-carboxamide.
| Compound Name | 1-[2-[[1-[[benzylsulfanyl(methyl)amino]methyl]cyclohexyl]carbamoylamino]-3,3-dimethylbutanoyl]-N-(1,2-dioxohept-6-yn-3-yl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 143104425 |
| Molecular Formula | C34H49N5O5S |
| Molecular Weight | 639.86 g/mol |
| Exact Mass | 639.35 |
| IUPAC Name | 1-[2-[[1-[[benzylsulfanyl(methyl)amino]methyl]cyclohexyl]carbamoylamino]-3,3-dimethylbutanoyl]-N-(1,2-dioxohept-6-yn-3-yl)pyrrolidine-2-carboxamide |
| SMILES | C#CCCC(NC(=O)C1CCCN1C(=O)C(NC(=O)NC1(CN(C)SCc2ccccc2)CCCCC1)C(C)(C)C)C(=O)C=O |
| InChI | InChI=1S/C34H49N5O5S/c1-6-7-17-26(28(41)22-40)35-30(42)27-18-14-21-39(27)31(43)29(33(2,3)4)36-32(44)37-34(19-12-9-13-20-34)24-38(5)45-23-25-15-10-8-11-16-25/h1,8,10-11,15-16,22,26-27,29H,7,9,12-14,17-21,23-24H2,2-5H3,(H,35,42)(H2,36,37,44) |
| InChIKey | OPCCTTVBBXGIHK-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 127.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.86 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|