C18H33N3O3S — CID 143105646
1-(2-tert-butylsulfinylcyclohexyl)-3-[2-(2-methylpyrrolidin-1-yl)-2-oxoethyl]urea (PubChem CID 143105646) has the molecular formula C18H33N3O3S and a molecular weight of 371.55 g/mol. Its IUPAC name is 1-(2-tert-butylsulfinylcyclohexyl)-3-[2-(2-methylpyrrolidin-1-yl)-2-oxoethyl]urea.
| Compound Name | 1-(2-tert-butylsulfinylcyclohexyl)-3-[2-(2-methylpyrrolidin-1-yl)-2-oxoethyl]urea |
|---|---|
| PubChem CID | 143105646 |
| Molecular Formula | C18H33N3O3S |
| Molecular Weight | 371.55 g/mol |
| Exact Mass | 371.22 |
| IUPAC Name | 1-(2-tert-butylsulfinylcyclohexyl)-3-[2-(2-methylpyrrolidin-1-yl)-2-oxoethyl]urea |
| SMILES | CC1CCCN1C(=O)CNC(=O)NC1CCCCC1S(=O)C(C)(C)C |
| InChI | InChI=1S/C18H33N3O3S/c1-13-8-7-11-21(13)16(22)12-19-17(23)20-14-9-5-6-10-15(14)25(24)18(2,3)4/h13-15H,5-12H2,1-4H3,(H2,19,20,23) |
| InChIKey | YUGQUWISDSUZPG-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.55 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |