C17H24O — CID 143107336
4,4-dimethyl-1-(2-methyl-4-propylphenyl)pent-1-yn-3-ol (PubChem CID 143107336) has the molecular formula C17H24O and a molecular weight of 244.38 g/mol. Its IUPAC name is 4,4-dimethyl-1-(2-methyl-4-propylphenyl)pent-1-yn-3-ol.
| Compound Name | 4,4-dimethyl-1-(2-methyl-4-propylphenyl)pent-1-yn-3-ol |
|---|---|
| PubChem CID | 143107336 |
| Molecular Formula | C17H24O |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.18 |
| IUPAC Name | 4,4-dimethyl-1-(2-methyl-4-propylphenyl)pent-1-yn-3-ol |
| SMILES | CCCc1ccc(C#CC(O)C(C)(C)C)c(C)c1 |
| InChI | InChI=1S/C17H24O/c1-6-7-14-8-9-15(13(2)12-14)10-11-16(18)17(3,4)5/h8-9,12,16,18H,6-7H2,1-5H3 |
| InChIKey | GVJQKBKVXZJSPG-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|