C34H50O4 — CID 143107374
(E)-1-[5-[3-[4-[(2,2-dimethyl-1,3-dioxan-5-yl)methoxy]-3-methylphenyl]pentan-3-yl]-3-methylcyclohepta-2,4,6-trien-1-yl]-4,4-dimethylpent-1-en-3-ol (PubChem CID 143107374) has the molecular formula C34H50O4 and a molecular weight of 522.77 g/mol. Its IUPAC name is (E)-1-[5-[3-[4-[(2,2-dimethyl-1,3-dioxan-5-yl)methoxy]-3-methylphenyl]pentan-3-yl]-3-methylcyclohepta-2,4,6-trien-1-yl]-4,4-dimethylpent-1-en-3-ol.
| Compound Name | (E)-1-[5-[3-[4-[(2,2-dimethyl-1,3-dioxan-5-yl)methoxy]-3-methylphenyl]pentan-3-yl]-3-methylcyclohepta-2,4,6-trien-1-yl]-4,4-dimethylpent-1-en-3-ol |
|---|---|
| PubChem CID | 143107374 |
| Molecular Formula | C34H50O4 |
| Molecular Weight | 522.77 g/mol |
| Exact Mass | 522.37 |
| IUPAC Name | (E)-1-[5-[3-[4-[(2,2-dimethyl-1,3-dioxan-5-yl)methoxy]-3-methylphenyl]pentan-3-yl]-3-methylcyclohepta-2,4,6-trien-1-yl]-4,4-dimethylpent-1-en-3-ol |
| SMILES | CCC(CC)(C1=CC(C)=CC(/C=C/C(O)C(C)(C)C)C=C1)c1ccc(OCC2COC(C)(C)OC2)c(C)c1 |
| InChI | InChI=1S/C34H50O4/c1-10-34(11-2,28-14-12-26(18-24(3)19-28)13-17-31(35)32(5,6)7)29-15-16-30(25(4)20-29)36-21-27-22-37-33(8,9)38-23-27/h12-20,26-27,31,35H,10-11,21-23H2,1-9H3/b17-13+ |
| InChIKey | RPEJVUYUSOJTTP-GHRIWEEISA-N |
| XLogP | 7.85 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.77 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|