C11H18OS — CID 143107632
(1Z,3E)-6-(oxiran-2-yl)-3-propylhexa-1,3-diene-1-thiol (PubChem CID 143107632) has the molecular formula C11H18OS and a molecular weight of 198.33 g/mol. Its IUPAC name is (1Z,3E)-6-(oxiran-2-yl)-3-propylhexa-1,3-diene-1-thiol.
| Compound Name | (1Z,3E)-6-(oxiran-2-yl)-3-propylhexa-1,3-diene-1-thiol |
|---|---|
| PubChem CID | 143107632 |
| Molecular Formula | C11H18OS |
| Molecular Weight | 198.33 g/mol |
| Exact Mass | 198.11 |
| IUPAC Name | (1Z,3E)-6-(oxiran-2-yl)-3-propylhexa-1,3-diene-1-thiol |
| SMILES | CCCC(/C=C\S)=C\CCC1CO1 |
| InChI | InChI=1S/C11H18OS/c1-2-4-10(7-8-13)5-3-6-11-9-12-11/h5,7-8,11,13H,2-4,6,9H2,1H3/b8-7-,10-5+ |
| InChIKey | JONIDDTWZDMWLN-GBLFQTLVSA-N |
| XLogP | 3.34 |
| TPSA | 12.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.33 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|