C13H18N2O — CID 143109237
1-(4-methoxybutyl)-3-methylimidazo[1,5-a]pyridine (PubChem CID 143109237) has the molecular formula C13H18N2O and a molecular weight of 218.30 g/mol. Its IUPAC name is 1-(4-methoxybutyl)-3-methylimidazo[1,5-a]pyridine.
| Compound Name | 1-(4-methoxybutyl)-3-methylimidazo[1,5-a]pyridine |
|---|---|
| PubChem CID | 143109237 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | 1-(4-methoxybutyl)-3-methylimidazo[1,5-a]pyridine |
| SMILES | COCCCCc1nc(C)n2ccccc12 |
| InChI | InChI=1S/C13H18N2O/c1-11-14-12(7-4-6-10-16-2)13-8-3-5-9-15(11)13/h3,5,8-9H,4,6-7,10H2,1-2H3 |
| InChIKey | CEIGQRUFDBTVDA-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 26.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|