C14H14N2S — CID 138756919
3-pyrrolo[1,2-a]quinoxalin-4-ylpropane-1-thiol (PubChem CID 138756919) has the molecular formula C14H14N2S and a molecular weight of 242.35 g/mol. Its IUPAC name is 3-pyrrolo[1,2-a]quinoxalin-4-ylpropane-1-thiol.
| Compound Name | 3-pyrrolo[1,2-a]quinoxalin-4-ylpropane-1-thiol |
|---|---|
| PubChem CID | 138756919 |
| Molecular Formula | C14H14N2S |
| Molecular Weight | 242.35 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | 3-pyrrolo[1,2-a]quinoxalin-4-ylpropane-1-thiol |
| SMILES | SCCCc1nc2ccccc2n2cccc12 |
| InChI | InChI=1S/C14H14N2S/c17-10-4-6-12-14-8-3-9-16(14)13-7-2-1-5-11(13)15-12/h1-3,5,7-9,17H,4,6,10H2 |
| InChIKey | IPGSYEAAMHZAGT-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 17.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.35 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|