C15H17N3 — CID 67303420
2-pentylpyrimido[1,2-a]benzimidazole (PubChem CID 67303420) has the molecular formula C15H17N3 and a molecular weight of 239.32 g/mol. Its IUPAC name is 2-pentylpyrimido[1,2-a]benzimidazole.
| Compound Name | 2-pentylpyrimido[1,2-a]benzimidazole |
|---|---|
| PubChem CID | 67303420 |
| Molecular Formula | C15H17N3 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.14 |
| IUPAC Name | 2-pentylpyrimido[1,2-a]benzimidazole |
| SMILES | CCCCCc1ccn2c(n1)nc1ccccc12 |
| InChI | InChI=1S/C15H17N3/c1-2-3-4-7-12-10-11-18-14-9-6-5-8-13(14)17-15(18)16-12/h5-6,8-11H,2-4,7H2,1H3 |
| InChIKey | RMNPPCROODGXSO-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|