C17H11IN2 — CID 162419329
4-(4-iodophenyl)pyrrolo[1,2-a]quinoxaline (PubChem CID 162419329) has the molecular formula C17H11IN2 and a molecular weight of 370.19 g/mol. Its IUPAC name is 4-(4-iodophenyl)pyrrolo[1,2-a]quinoxaline.
| Compound Name | 4-(4-iodophenyl)pyrrolo[1,2-a]quinoxaline |
|---|---|
| PubChem CID | 162419329 |
| Molecular Formula | C17H11IN2 |
| Molecular Weight | 370.19 g/mol |
| Exact Mass | 370.00 |
| IUPAC Name | 4-(4-iodophenyl)pyrrolo[1,2-a]quinoxaline |
| SMILES | Ic1ccc(-c2nc3ccccc3n3cccc23)cc1 |
| InChI | InChI=1S/C17H11IN2/c18-13-9-7-12(8-10-13)17-16-6-3-11-20(16)15-5-2-1-4-14(15)19-17/h1-11H |
| InChIKey | PHBOEFMOULJZTG-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.19 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|