C17H10N4 — CID 12911598
4-imidazo[1,2-a]quinoxalin-4-ylbenzonitrile (PubChem CID 12911598) has the molecular formula C17H10N4 and a molecular weight of 270.30 g/mol. Its IUPAC name is 4-imidazo[1,2-a]quinoxalin-4-ylbenzonitrile.
| Compound Name | 4-imidazo[1,2-a]quinoxalin-4-ylbenzonitrile |
|---|---|
| PubChem CID | 12911598 |
| Molecular Formula | C17H10N4 |
| Molecular Weight | 270.30 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | 4-imidazo[1,2-a]quinoxalin-4-ylbenzonitrile |
| SMILES | N#Cc1ccc(-c2nc3ccccc3n3ccnc23)cc1 |
| InChI | InChI=1S/C17H10N4/c18-11-12-5-7-13(8-6-12)16-17-19-9-10-21(17)15-4-2-1-3-14(15)20-16/h1-10H |
| InChIKey | MHRWPEFORHPSQT-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 53.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.30 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |