C11H6N4 — CID 82401393
pyrimido[1,2-a]benzimidazole-3-carbonitrile (PubChem CID 82401393) has the molecular formula C11H6N4 and a molecular weight of 194.20 g/mol. Its IUPAC name is pyrimido[1,2-a]benzimidazole-3-carbonitrile.
| Compound Name | pyrimido[1,2-a]benzimidazole-3-carbonitrile |
|---|---|
| PubChem CID | 82401393 |
| Molecular Formula | C11H6N4 |
| Molecular Weight | 194.20 g/mol |
| Exact Mass | 194.06 |
| IUPAC Name | pyrimido[1,2-a]benzimidazole-3-carbonitrile |
| SMILES | N#Cc1cnc2nc3ccccc3n2c1 |
| InChI | InChI=1S/C11H6N4/c12-5-8-6-13-11-14-9-3-1-2-4-10(9)15(11)7-8/h1-4,6-7H |
| InChIKey | UCVSKEWIBRMFMB-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 53.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.20 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |