C17H13N3 — CID 165178310
3-(3-methylphenyl)pyrimido[1,2-a]benzimidazole (PubChem CID 165178310) has the molecular formula C17H13N3 and a molecular weight of 259.31 g/mol. Its IUPAC name is 3-(3-methylphenyl)pyrimido[1,2-a]benzimidazole.
| Compound Name | 3-(3-methylphenyl)pyrimido[1,2-a]benzimidazole |
|---|---|
| PubChem CID | 165178310 |
| Molecular Formula | C17H13N3 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | 3-(3-methylphenyl)pyrimido[1,2-a]benzimidazole |
| SMILES | Cc1cccc(-c2cnc3nc4ccccc4n3c2)c1 |
| InChI | InChI=1S/C17H13N3/c1-12-5-4-6-13(9-12)14-10-18-17-19-15-7-2-3-8-16(15)20(17)11-14/h2-11H,1H3 |
| InChIKey | XHWMAPVWXVDYNB-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |