About 2,6-dimethyl-3-phenylimidazo[1,2-a]pyrimidine
2,6-dimethyl-3-phenylimidazo[1,2-a]pyrimidine (PubChem CID 70797858) has the molecular formula C14H13N3
and a molecular weight of 223.28 g/mol. Its IUPAC name is 2,6-dimethyl-3-phenylimidazo[1,2-a]pyrimidine.
Molecular Properties
| Compound Name | 2,6-dimethyl-3-phenylimidazo[1,2-a]pyrimidine |
| PubChem CID | 70797858 |
| Molecular Formula | C14H13N3 |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | 2,6-dimethyl-3-phenylimidazo[1,2-a]pyrimidine |
| SMILES | Cc1cnc2nc(C)c(-c3ccccc3)n2c1 |
| InChI | InChI=1S/C14H13N3/c1-10-8-15-14-16-11(2)13(17(14)9-10)12-6-4-3-5-7-12/h3-9H,1-2H3 |
| InChIKey | PLDUVNBXFCZNMF-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,6-dimethyl-3-phenylimidazo[1,2-a]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dimethyl-3-phenylimidazo[1,2-a]pyrimidine?
The IUPAC name of 2,6-dimethyl-3-phenylimidazo[1,2-a]pyrimidine (CID 70797858) is 2,6-dimethyl-3-phenylimidazo[1,2-a]pyrimidine.
What is the SMILES notation for 2,6-dimethyl-3-phenylimidazo[1,2-a]pyrimidine?
The canonical SMILES for 2,6-dimethyl-3-phenylimidazo[1,2-a]pyrimidine is Cc1cnc2nc(C)c(-c3ccccc3)n2c1.
What is the InChIKey of 2,6-dimethyl-3-phenylimidazo[1,2-a]pyrimidine?
The InChIKey is PLDUVNBXFCZNMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13N3/c1-10-8-15-14-16-11(2)13(17(14)9-10)12-6-4-3-5-7-12/h3-9H,1-2H3.
What are the key properties of 2,6-dimethyl-3-phenylimidazo[1,2-a]pyrimidine?
2,6-dimethyl-3-phenylimidazo[1,2-a]pyrimidine has a molecular weight of 223.28 g/mol, XLogP of 3.01, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dimethyl-3-phenylimidazo[1,2-a]pyrimidine is sourced from PubChem (CID 70797858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).