C13H12N2 — CID 102458762
4-ethylpyrrolo[1,2-a]quinoxaline (PubChem CID 102458762) has the molecular formula C13H12N2 and a molecular weight of 196.25 g/mol. Its IUPAC name is 4-ethylpyrrolo[1,2-a]quinoxaline.
| Compound Name | 4-ethylpyrrolo[1,2-a]quinoxaline |
|---|---|
| PubChem CID | 102458762 |
| Molecular Formula | C13H12N2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | 4-ethylpyrrolo[1,2-a]quinoxaline |
| SMILES | CCc1nc2ccccc2n2cccc12 |
| InChI | InChI=1S/C13H12N2/c1-2-10-12-8-5-9-15(12)13-7-4-3-6-11(13)14-10/h3-9H,2H2,1H3 |
| InChIKey | WXMSRWLJBZBXIC-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |