C12H10Cl2N4 — CID 13133618
1-(dichloromethyl)-4-ethyl-[1,2,4]triazolo[4,3-a]quinoxaline (PubChem CID 13133618) has the molecular formula C12H10Cl2N4 and a molecular weight of 281.15 g/mol. Its IUPAC name is 1-(dichloromethyl)-4-ethyl-[1,2,4]triazolo[4,3-a]quinoxaline.
| Compound Name | 1-(dichloromethyl)-4-ethyl-[1,2,4]triazolo[4,3-a]quinoxaline |
|---|---|
| PubChem CID | 13133618 |
| Molecular Formula | C12H10Cl2N4 |
| Molecular Weight | 281.15 g/mol |
| Exact Mass | 280.03 |
| IUPAC Name | 1-(dichloromethyl)-4-ethyl-[1,2,4]triazolo[4,3-a]quinoxaline |
| SMILES | CCc1nc2ccccc2n2c(C(Cl)Cl)nnc12 |
| InChI | InChI=1S/C12H10Cl2N4/c1-2-7-11-16-17-12(10(13)14)18(11)9-6-4-3-5-8(9)15-7/h3-6,10H,2H2,1H3 |
| InChIKey | OBMRJTNXHPOKEY-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.15 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|