C20H20N4O4 — CID 139229651
(2R,3R)-1-(4-benzyl-[1,2,4]triazolo[4,3-a]quinoxalin-1-yl)butane-1,2,3,4-tetrol (PubChem CID 139229651) has the molecular formula C20H20N4O4 and a molecular weight of 380.40 g/mol. Its IUPAC name is (2R,3R)-1-(4-benzyl-[1,2,4]triazolo[4,3-a]quinoxalin-1-yl)butane-1,2,3,4-tetrol.
| Compound Name | (2R,3R)-1-(4-benzyl-[1,2,4]triazolo[4,3-a]quinoxalin-1-yl)butane-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 139229651 |
| Molecular Formula | C20H20N4O4 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | (2R,3R)-1-(4-benzyl-[1,2,4]triazolo[4,3-a]quinoxalin-1-yl)butane-1,2,3,4-tetrol |
| SMILES | OC[C@@H](O)[C@H](O)C(O)c1nnc2c(Cc3ccccc3)nc3ccccc3n12 |
| InChI | InChI=1S/C20H20N4O4/c25-11-16(26)17(27)18(28)20-23-22-19-14(10-12-6-2-1-3-7-12)21-13-8-4-5-9-15(13)24(19)20/h1-9,16-18,25-28H,10-11H2/t16-,17+,18?/m1/s1 |
| InChIKey | SMKBUHVJNMOHJV-DVKDBIPTSA-N |
| XLogP | 0.62 |
| TPSA | 124.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |