C15H23FO — CID 143112825
(4Z,7E)-9-ethenyl-10,10-diethyl-7-fluoro-2,3,6,9-tetrahydrooxecine (PubChem CID 143112825) has the molecular formula C15H23FO and a molecular weight of 238.35 g/mol. Its IUPAC name is (4Z,7E)-9-ethenyl-10,10-diethyl-7-fluoro-2,3,6,9-tetrahydrooxecine.
| Compound Name | (4Z,7E)-9-ethenyl-10,10-diethyl-7-fluoro-2,3,6,9-tetrahydrooxecine |
|---|---|
| PubChem CID | 143112825 |
| Molecular Formula | C15H23FO |
| Molecular Weight | 238.35 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | (4Z,7E)-9-ethenyl-10,10-diethyl-7-fluoro-2,3,6,9-tetrahydrooxecine |
| SMILES | C=CC1/C=C(/F)C/C=C\CCOC1(CC)CC |
| InChI | InChI=1S/C15H23FO/c1-4-13-12-14(16)10-8-7-9-11-17-15(13,5-2)6-3/h4,7-8,12-13H,1,5-6,9-11H2,2-3H3/b8-7-,14-12+ |
| InChIKey | OEKCXXWYUCPDEU-SXOVAMJMSA-N |
| XLogP | 4.57 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.35 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|