C11H21FO — CID 123729444
2-(2-fluoroethoxy)-4,5-dimethylhept-2-ene (PubChem CID 123729444) has the molecular formula C11H21FO and a molecular weight of 188.29 g/mol. Its IUPAC name is 2-(2-fluoroethoxy)-4,5-dimethylhept-2-ene.
| Compound Name | 2-(2-fluoroethoxy)-4,5-dimethylhept-2-ene |
|---|---|
| PubChem CID | 123729444 |
| Molecular Formula | C11H21FO |
| Molecular Weight | 188.29 g/mol |
| Exact Mass | 188.16 |
| IUPAC Name | 2-(2-fluoroethoxy)-4,5-dimethylhept-2-ene |
| SMILES | CCC(C)C(C)C=C(C)OCCF |
| InChI | InChI=1S/C11H21FO/c1-5-9(2)10(3)8-11(4)13-7-6-12/h8-10H,5-7H2,1-4H3 |
| InChIKey | KRWFAACDOPBZEA-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.29 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|