C15H23F3O — CID 91235536
2,3-dimethyl-7-(2,2,2-trifluoroethoxy)undeca-1,6,9-triene (PubChem CID 91235536) has the molecular formula C15H23F3O and a molecular weight of 276.34 g/mol. Its IUPAC name is 2,3-dimethyl-7-(2,2,2-trifluoroethoxy)undeca-1,6,9-triene.
| Compound Name | 2,3-dimethyl-7-(2,2,2-trifluoroethoxy)undeca-1,6,9-triene |
|---|---|
| PubChem CID | 91235536 |
| Molecular Formula | C15H23F3O |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | 2,3-dimethyl-7-(2,2,2-trifluoroethoxy)undeca-1,6,9-triene |
| SMILES | C=C(C)C(C)CCC=C(CC=CC)OCC(F)(F)F |
| InChI | InChI=1S/C15H23F3O/c1-5-6-9-14(19-11-15(16,17)18)10-7-8-13(4)12(2)3/h5-6,10,13H,2,7-9,11H2,1,3-4H3 |
| InChIKey | LYPIYMCNINUTGQ-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|