C13H25FO — CID 123166155
2-(1-fluoroethoxy)-7,8-dimethylnon-2-ene (PubChem CID 123166155) has the molecular formula C13H25FO and a molecular weight of 216.34 g/mol. Its IUPAC name is 2-(1-fluoroethoxy)-7,8-dimethylnon-2-ene.
| Compound Name | 2-(1-fluoroethoxy)-7,8-dimethylnon-2-ene |
|---|---|
| PubChem CID | 123166155 |
| Molecular Formula | C13H25FO |
| Molecular Weight | 216.34 g/mol |
| Exact Mass | 216.19 |
| IUPAC Name | 2-(1-fluoroethoxy)-7,8-dimethylnon-2-ene |
| SMILES | CC(=CCCCC(C)C(C)C)OC(C)F |
| InChI | InChI=1S/C13H25FO/c1-10(2)11(3)8-6-7-9-12(4)15-13(5)14/h9-11,13H,6-8H2,1-5H3 |
| InChIKey | YWSUVWUAEMHSKY-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.34 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|