C12H22O — CID 158209023
(4S)-2-butan-2-yl-3,4,6-trimethyl-3,4-dihydro-2H-pyran (PubChem CID 158209023) has the molecular formula C12H22O and a molecular weight of 182.31 g/mol. Its IUPAC name is (4S)-2-butan-2-yl-3,4,6-trimethyl-3,4-dihydro-2H-pyran.
| Compound Name | (4S)-2-butan-2-yl-3,4,6-trimethyl-3,4-dihydro-2H-pyran |
|---|---|
| PubChem CID | 158209023 |
| Molecular Formula | C12H22O |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.17 |
| IUPAC Name | (4S)-2-butan-2-yl-3,4,6-trimethyl-3,4-dihydro-2H-pyran |
| SMILES | CCC(C)C1OC(C)=C[C@@H](C)C1C |
| InChI | InChI=1S/C12H22O/c1-6-8(2)12-11(5)9(3)7-10(4)13-12/h7-9,11-12H,6H2,1-5H3/t8?,9-,11?,12?/m1/s1 |
| InChIKey | GBVMVCRENUUTGB-QGHFROFYSA-N |
| XLogP | 3.61 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |