C10H17FO — CID 122448719
(4R,5S)-4-fluoro-5-methyl-1-propan-2-yloxycyclohexene (PubChem CID 122448719) has the molecular formula C10H17FO and a molecular weight of 172.24 g/mol. Its IUPAC name is (4R,5S)-4-fluoro-5-methyl-1-propan-2-yloxycyclohexene.
| Compound Name | (4R,5S)-4-fluoro-5-methyl-1-propan-2-yloxycyclohexene |
|---|---|
| PubChem CID | 122448719 |
| Molecular Formula | C10H17FO |
| Molecular Weight | 172.24 g/mol |
| Exact Mass | 172.13 |
| IUPAC Name | (4R,5S)-4-fluoro-5-methyl-1-propan-2-yloxycyclohexene |
| SMILES | CC(C)OC1=CC[C@@H](F)[C@@H](C)C1 |
| InChI | InChI=1S/C10H17FO/c1-7(2)12-9-4-5-10(11)8(3)6-9/h4,7-8,10H,5-6H2,1-3H3/t8-,10+/m0/s1 |
| InChIKey | SUXDIPVYRMRMPW-WCBMZHEXSA-N |
| XLogP | 3.06 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.24 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |