C15H23FO — CID 54020045
6-fluoro-5-methyl-2-[2-(4-methylcyclohex-3-en-1-yl)ethyl]-3,4-dihydro-2H-pyran (PubChem CID 54020045) has the molecular formula C15H23FO and a molecular weight of 238.35 g/mol. Its IUPAC name is 6-fluoro-5-methyl-2-[2-(4-methylcyclohex-3-en-1-yl)ethyl]-3,4-dihydro-2H-pyran.
| Compound Name | 6-fluoro-5-methyl-2-[2-(4-methylcyclohex-3-en-1-yl)ethyl]-3,4-dihydro-2H-pyran |
|---|---|
| PubChem CID | 54020045 |
| Molecular Formula | C15H23FO |
| Molecular Weight | 238.35 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | 6-fluoro-5-methyl-2-[2-(4-methylcyclohex-3-en-1-yl)ethyl]-3,4-dihydro-2H-pyran |
| SMILES | CC1=CCC(CCC2CCC(C)=C(F)O2)CC1 |
| InChI | InChI=1S/C15H23FO/c1-11-3-6-13(7-4-11)8-10-14-9-5-12(2)15(16)17-14/h3,13-14H,4-10H2,1-2H3 |
| InChIKey | KYHHIWQRVNFNHZ-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.35 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|