C16H27FO — CID 21337849
1-(fluoromethoxy)-4-[2-(4-methylcyclohexyl)ethyl]cyclohexene (PubChem CID 21337849) has the molecular formula C16H27FO and a molecular weight of 254.39 g/mol. Its IUPAC name is 1-(fluoromethoxy)-4-[2-(4-methylcyclohexyl)ethyl]cyclohexene.
| Compound Name | 1-(fluoromethoxy)-4-[2-(4-methylcyclohexyl)ethyl]cyclohexene |
|---|---|
| PubChem CID | 21337849 |
| Molecular Formula | C16H27FO |
| Molecular Weight | 254.39 g/mol |
| Exact Mass | 254.20 |
| IUPAC Name | 1-(fluoromethoxy)-4-[2-(4-methylcyclohexyl)ethyl]cyclohexene |
| SMILES | CC1CCC(CCC2CC=C(OCF)CC2)CC1 |
| InChI | InChI=1S/C16H27FO/c1-13-2-4-14(5-3-13)6-7-15-8-10-16(11-9-15)18-12-17/h10,13-15H,2-9,11-12H2,1H3 |
| InChIKey | ZTMHLLRILOZRPR-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.39 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |