C16H27FO — CID 57249230
2-(4-fluorocyclohex-3-en-1-yl)-5-pentyloxane (PubChem CID 57249230) has the molecular formula C16H27FO and a molecular weight of 254.39 g/mol. Its IUPAC name is 2-(4-fluorocyclohex-3-en-1-yl)-5-pentyloxane.
| Compound Name | 2-(4-fluorocyclohex-3-en-1-yl)-5-pentyloxane |
|---|---|
| PubChem CID | 57249230 |
| Molecular Formula | C16H27FO |
| Molecular Weight | 254.39 g/mol |
| Exact Mass | 254.20 |
| IUPAC Name | 2-(4-fluorocyclohex-3-en-1-yl)-5-pentyloxane |
| SMILES | CCCCCC1CCC(C2CC=C(F)CC2)OC1 |
| InChI | InChI=1S/C16H27FO/c1-2-3-4-5-13-6-11-16(18-12-13)14-7-9-15(17)10-8-14/h9,13-14,16H,2-8,10-12H2,1H3 |
| InChIKey | ANDRJNLTDYDURJ-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.39 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|