About 2-fluoro-6-methoxy-3-methyl-4-propan-2-yl-1λ3-iodacyclohepta-5,7-diene
2-fluoro-6-methoxy-3-methyl-4-propan-2-yl-1λ3-iodacyclohepta-5,7-diene (PubChem CID 163529704) has the molecular formula C11H18FIO
and a molecular weight of 312.17 g/mol. Its IUPAC name is 2-fluoro-6-methoxy-3-methyl-4-propan-2-yl-1λ3-iodacyclohepta-5,7-diene.
Molecular Properties
| Compound Name | 2-fluoro-6-methoxy-3-methyl-4-propan-2-yl-1λ3-iodacyclohepta-5,7-diene |
| PubChem CID | 163529704 |
| Molecular Formula | C11H18FIO |
| Molecular Weight | 312.17 g/mol |
| Exact Mass | 312.04 |
| IUPAC Name | 2-fluoro-6-methoxy-3-methyl-4-propan-2-yl-1λ3-iodacyclohepta-5,7-diene |
| SMILES | COC1=CC(C(C)C)C(C)C(F)I=C1 |
| InChI | InChI=1S/C11H18FIO/c1-7(2)10-5-9(14-4)6-13-11(12)8(10)3/h5-8,10-11H,1-4H3 |
| InChIKey | DRWFXIKNTODGCU-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.17 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-6-methoxy-3-methyl-4-propan-2-yl-1λ3-iodacyclohepta-5,7-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-6-methoxy-3-methyl-4-propan-2-yl-1λ3-iodacyclohepta-5,7-diene?
The IUPAC name of 2-fluoro-6-methoxy-3-methyl-4-propan-2-yl-1λ3-iodacyclohepta-5,7-diene (CID 163529704) is 2-fluoro-6-methoxy-3-methyl-4-propan-2-yl-1λ3-iodacyclohepta-5,7-diene.
What is the SMILES notation for 2-fluoro-6-methoxy-3-methyl-4-propan-2-yl-1λ3-iodacyclohepta-5,7-diene?
The canonical SMILES for 2-fluoro-6-methoxy-3-methyl-4-propan-2-yl-1λ3-iodacyclohepta-5,7-diene is COC1=CC(C(C)C)C(C)C(F)I=C1.
What is the InChIKey of 2-fluoro-6-methoxy-3-methyl-4-propan-2-yl-1λ3-iodacyclohepta-5,7-diene?
The InChIKey is DRWFXIKNTODGCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18FIO/c1-7(2)10-5-9(14-4)6-13-11(12)8(10)3/h5-8,10-11H,1-4H3.
What are the key properties of 2-fluoro-6-methoxy-3-methyl-4-propan-2-yl-1λ3-iodacyclohepta-5,7-diene?
2-fluoro-6-methoxy-3-methyl-4-propan-2-yl-1λ3-iodacyclohepta-5,7-diene has a molecular weight of 312.17 g/mol, XLogP of 3.51, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-6-methoxy-3-methyl-4-propan-2-yl-1λ3-iodacyclohepta-5,7-diene is sourced from PubChem (CID 163529704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).