C12H23N3O3 — CID 143113720
1-[3-(1-hydroxyprop-2-enyl)-5-(1-hydroxypropyl)-1,3,5-triazinan-1-yl]propan-1-one (PubChem CID 143113720) has the molecular formula C12H23N3O3 and a molecular weight of 257.33 g/mol. Its IUPAC name is 1-[3-(1-hydroxyprop-2-enyl)-5-(1-hydroxypropyl)-1,3,5-triazinan-1-yl]propan-1-one.
| Compound Name | 1-[3-(1-hydroxyprop-2-enyl)-5-(1-hydroxypropyl)-1,3,5-triazinan-1-yl]propan-1-one |
|---|---|
| PubChem CID | 143113720 |
| Molecular Formula | C12H23N3O3 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.17 |
| IUPAC Name | 1-[3-(1-hydroxyprop-2-enyl)-5-(1-hydroxypropyl)-1,3,5-triazinan-1-yl]propan-1-one |
| SMILES | C=CC(O)N1CN(C(=O)CC)CN(C(O)CC)C1 |
| InChI | InChI=1S/C12H23N3O3/c1-4-10(16)13-7-14(11(17)5-2)9-15(8-13)12(18)6-3/h4,10-11,16-17H,1,5-9H2,2-3H3 |
| InChIKey | GAWWHPKLNCMSPR-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 67.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|