C11H11BrFNO2 — CID 143113789
2-(5-bromo-7-fluoro-2-methyl-1H-indol-3-yl)ethane-1,1-diol (PubChem CID 143113789) has the molecular formula C11H11BrFNO2 and a molecular weight of 288.12 g/mol. Its IUPAC name is 2-(5-bromo-7-fluoro-2-methyl-1H-indol-3-yl)ethane-1,1-diol.
| Compound Name | 2-(5-bromo-7-fluoro-2-methyl-1H-indol-3-yl)ethane-1,1-diol |
|---|---|
| PubChem CID | 143113789 |
| Molecular Formula | C11H11BrFNO2 |
| Molecular Weight | 288.12 g/mol |
| Exact Mass | 287.00 |
| IUPAC Name | 2-(5-bromo-7-fluoro-2-methyl-1H-indol-3-yl)ethane-1,1-diol |
| SMILES | Cc1[nH]c2c(F)cc(Br)cc2c1CC(O)O |
| InChI | InChI=1S/C11H11BrFNO2/c1-5-7(4-10(15)16)8-2-6(12)3-9(13)11(8)14-5/h2-3,10,14-16H,4H2,1H3 |
| InChIKey | GJFOTQFQIMVQLQ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 56.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.12 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|