C19H24O2 — CID 143113792
2-[3-[(Z)-2-ethenylideneoct-6-enyl]phenyl]propanoic acid (PubChem CID 143113792) has the molecular formula C19H24O2 and a molecular weight of 284.40 g/mol. Its IUPAC name is 2-[3-[(Z)-2-ethenylideneoct-6-enyl]phenyl]propanoic acid.
| Compound Name | 2-[3-[(Z)-2-ethenylideneoct-6-enyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 143113792 |
| Molecular Formula | C19H24O2 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.18 |
| IUPAC Name | 2-[3-[(Z)-2-ethenylideneoct-6-enyl]phenyl]propanoic acid |
| SMILES | C=C=C(CCC/C=C\C)Cc1cccc(C(C)C(=O)O)c1 |
| InChI | InChI=1S/C19H24O2/c1-4-6-7-8-10-16(5-2)13-17-11-9-12-18(14-17)15(3)19(20)21/h4,6,9,11-12,14-15H,2,7-8,10,13H2,1,3H3,(H,20,21)/b6-4- |
| InChIKey | YELLXIQFGHFLLZ-XQRVVYSFSA-N |
| XLogP | 4.87 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|