C14H19NO7 — CID 67389415
2-[3-[(2-hydroxyethylamino)methyl]phenyl]propanoic acid;oxalic acid (PubChem CID 67389415) has the molecular formula C14H19NO7 and a molecular weight of 313.31 g/mol. Its IUPAC name is 2-[3-[(2-hydroxyethylamino)methyl]phenyl]propanoic acid;oxalic acid.
| Compound Name | 2-[3-[(2-hydroxyethylamino)methyl]phenyl]propanoic acid;oxalic acid |
|---|---|
| PubChem CID | 67389415 |
| Molecular Formula | C14H19NO7 |
| Molecular Weight | 313.31 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | 2-[3-[(2-hydroxyethylamino)methyl]phenyl]propanoic acid;oxalic acid |
| SMILES | CC(C(=O)O)c1cccc(CNCCO)c1.O=C(O)C(=O)O |
| InChI | InChI=1S/C12H17NO3.C2H2O4/c1-9(12(15)16)11-4-2-3-10(7-11)8-13-5-6-14;3-1(4)2(5)6/h2-4,7,9,13-14H,5-6,8H2,1H3,(H,15,16);(H,3,4)(H,5,6) |
| InChIKey | DAIRYYXCFGUCKY-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 144.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.31 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|