C9H16N2 — CID 143115331
N-methyl-3-[(Z)-prop-1-enyl]iminopent-4-en-1-amine (PubChem CID 143115331) has the molecular formula C9H16N2 and a molecular weight of 152.24 g/mol. Its IUPAC name is N-methyl-3-[(Z)-prop-1-enyl]iminopent-4-en-1-amine.
| Compound Name | N-methyl-3-[(Z)-prop-1-enyl]iminopent-4-en-1-amine |
|---|---|
| PubChem CID | 143115331 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | N-methyl-3-[(Z)-prop-1-enyl]iminopent-4-en-1-amine |
| SMILES | C=C/C(CCNC)=N\C=C/C |
| InChI | InChI=1S/C9H16N2/c1-4-7-11-9(5-2)6-8-10-3/h4-5,7,10H,2,6,8H2,1,3H3/b7-4-,11-9+ |
| InChIKey | BLKNBIVLUXTVSE-RGSRAZRCSA-N |
| XLogP | 1.76 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|